6973-77-9 N-(1-나프틸)말레아민산
상품명칭 |
N-(1-나프틸)말레아민산 |
별명 |
; N-(1-나프틸)말레아민산; (2Z)-4-(나프탈렌-1-일아미노)-4-옥소부트-2-에노산 |
영문 이름 |
N-(1-Naphthyl)maleamic acid; N-(1-Naphthyl)maleamic acid; (2Z)-4-(naphthalen-1-ylamino)-4-oxobut-2-enoic acid |
분자식 |
C14H11NO3 |
분자량 |
241.242 |
InChI |
InChI=1/C14H11NO3/c16-13(8-9-14(17)18)15-12-7-3-5-10-4-1-2-6-11(10)12/h1-9H,(H,15,16)(H,17,18)/b9-8- |
cas번호 |
6973-77-9 |
분자 구조 |
|
밀도 |
1.356g/cm3 |
비등점 |
533.9°C at 760 mmHg |
굴절 지수 |
1.706 |
인화점 |
276.7°C |
증기압 |
3.15E-12mmHg at 25°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|