ChemNet > CAS > 7355-22-8 5-Bromo-§
7355-22-8 5-Bromo-§
상품명칭 |
5-Bromo-§ |
별명 |
5-Bromo-2,4-dihydroxybenzoic acid monohydrate; 5-bromo-2,4-dihydroxybenzoic acid |
분자식 |
C7H5BrO4 |
분자량 |
233.0162 |
InChI |
InChI=1/C7H5BrO4/c8-4-1-3(7(11)12)5(9)2-6(4)10/h1-2,9-10H,(H,11,12) |
cas번호 |
7355-22-8 |
EC번호 |
230-881-9 |
분자 구조 |
|
밀도 |
2.026g/cm3 |
비등점 |
436.7°C at 760 mmHg |
굴절 지수 |
1.703 |
인화점 |
217.9°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|