상품명칭 |
2,4- 디 페닐 -5,6,7,8- 테트라 히드로 크롬닐륨 트리 플루오 로메탄 술포네이트 |
별명 |
; 2,4- 디 페닐 -5,6,7,8- 테트라 하이드로 크롬닐륨 트리 플루오 로메탄 술 포 네이트; 2,4- 디 페닐 -5,6,7,8- 테트라 하이드로 크롬 늄 트리 플루오 로메탄 술 포 네이트 |
영문 이름 |
2,4-Diphenyl-5,6,7,8-tetrahydrochromenylium trifluoromethanesulphonate; 2,4-Diphenyl-5,6,7,8-tetrahydrochromenylium trifluoromethanesulfonate; 2,4-diphenyl-5,6,7,8-tetrahydrochromenium trifluoromethanesulfonate |
분자식 |
C22H19F3O4S |
분자량 |
436.4441 |
InChI |
InChI=1/C21H19O.CHF3O3S/c1-3-9-16(10-4-1)19-15-21(17-11-5-2-6-12-17)22-20-14-8-7-13-18(19)20;2-1(3,4)8(5,6)7/h1-6,9-12,15H,7-8,13-14H2;(H,5,6,7)/q+1;/p-1 |
cas번호 |
81128-01-0 |
분자 구조 |
|
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|