ChemNet > CAS > 9003-42-3 Poly(ethyl methacrylate)
9003-42-3 Poly(ethyl methacrylate)
상품명칭 |
Poly(ethyl methacrylate) |
별명 |
Ethyl Methacrylate Resin; ethyl 2-methylprop-2-enoate |
분자식 |
C6H10O2 |
분자량 |
114.1424 |
InChI |
InChI=1/C6H10O2/c1-4-8-6(7)5(2)3/h2,4H2,1,3H3 |
cas번호 |
9003-42-3 |
EC번호 |
202-597-5 |
분자 구조 |
|
밀도 |
0.906g/cm3 |
비등점 |
120.5°C at 760 mmHg |
굴절 지수 |
1.409 |
인화점 |
15.6°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|