ChemNet > CAS > 10047-28-6 butyl thioglycolate
10047-28-6 butyl thioglycolate
Nama produk |
butyl thioglycolate |
MF |
C6H12O2S |
Berat Molekul |
148.2233 |
InChI |
InChI=1/C6H12O2S/c1-2-3-4-9-6(8)5-7/h7H,2-5H2,1H3 |
CAS NO |
10047-28-6 |
EINECS |
233-156-5 |
Struktur Molekul |
|
Kepadatan |
1.088g/cm3 |
Titik didih |
220.125°C at 760 mmHg |
Indeks bias |
1.491 |
Titik nyala |
86.929°C |
Cinta bahaya |
|
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Penerangan |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|