ChemNet > CAS > 108847-20-7 Dibenzothiophene-4-boronic acid
108847-20-7 Dibenzothiophene-4-boronic acid
| Nama produk |
Dibenzothiophene-4-boronic acid |
| Sinonim |
Dibenzo[b,d]thiophen-4-ylboronic acid; 4-Dibenzothienylboronic acid; 4-DIBENZOTHIOPHENEBORONIC ACID |
| MF |
C12H9BO2S |
| Berat Molekul |
228.0747 |
| InChI |
InChI=1/C12H9BO2S/c14-13(15)10-6-3-5-9-8-4-1-2-7-11(8)16-12(9)10/h1-7,14-15H |
| CAS NO |
108847-20-7 |
| Struktur Molekul |
|
| Kepadatan |
1.38g/cm3 |
| Titik lebur |
327-330℃ |
| Titik didih |
480.2°C at 760 mmHg |
| Indeks bias |
1.738 |
| Titik nyala |
244.2°C |
| Cinta bahaya |
 Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S22:;
S24/25:;
|
|
