ChemNet > CAS > 113053-50-2 Methyl 1,2,3-benzotriazole-5-carboxylate
113053-50-2 Methyl 1,2,3-benzotriazole-5-carboxylate
Nama produk |
Methyl 1,2,3-benzotriazole-5-carboxylate |
Sinonim |
Methyl 1H-1,2,3-benzotriazole-5-carboxylate; methyl 2H-benzotriazole-5-carboxylate |
MF |
C8H7N3O2 |
Berat Molekul |
177.1601 |
InChI |
InChI=1/C8H7N3O2/c1-13-8(12)5-2-3-6-7(4-5)10-11-9-6/h2-4H,1H3,(H,9,10,11) |
CAS NO |
113053-50-2 |
Struktur Molekul |
|
Kepadatan |
1.403g/cm3 |
Titik lebur |
169-179℃ |
Titik didih |
349.3°C at 760 mmHg |
Indeks bias |
1.658 |
Titik nyala |
165.1°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|