ChemNet > CAS > 1171-47-7 2,2-Bis-(4-carboxyphenyl)-hexafluoropropane
1171-47-7 2,2-Bis-(4-carboxyphenyl)-hexafluoropropane
Nama produk |
2,2-Bis-(4-carboxyphenyl)-hexafluoropropane |
MF |
C7H11FO2 |
Berat Molekul |
146.1594 |
InChI |
InChI=1/C7H11FO2/c8-7(6(9)10)4-2-1-3-5-7/h1-5H2,(H,9,10) |
CAS NO |
1171-47-7 |
Struktur Molekul |
|
Kepadatan |
1.159g/cm3 |
Titik didih |
227.566°C at 760 mmHg |
Indeks bias |
1.454 |
Titik nyala |
91.429°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|