ChemNet > CAS > 14181-72-7 2-bromo-1-phenyl-1-ethanone oxime
14181-72-7 2-bromo-1-phenyl-1-ethanone oxime
| Nama produk |
2-bromo-1-phenyl-1-ethanone oxime |
| Sinonim |
2-bromo-N-hydroxy-1-phenylethanimine; (1Z)-2-bromo-1-phenylethanone oxime |
| Nama Inggeris |
2-bromo-1-phenyl-1-ethanone oxime;2-bromo-N-hydroxy-1-phenylethanimine; (1Z)-2-bromo-1-phenylethanone oxime |
| MF |
C8H8BrNO |
| Berat Molekul |
214.0592 |
| InChI |
InChI=1/C8H8BrNO/c9-6-8(10-11)7-4-2-1-3-5-7/h1-5,11H,6H2/b10-8+ |
| CAS NO |
14181-72-7 |
| Struktur Molekul |
|
| Kepadatan |
1.45g/cm3 |
| Titik lebur |
97℃ |
| Titik didih |
296.8°C at 760 mmHg |
| Indeks bias |
1.57 |
| Titik nyala |
133.3°C |
| Tekanan wap |
0.00063mmHg at 25°C |
| Cinta bahaya |
C:Corrosive;
|
| Kod Risiko |
R34:Causes burns.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|