ChemNet > CAS > 179113-89-4 3,5-difluorobenzophenone
179113-89-4 3,5-difluorobenzophenone
Nama produk |
3,5-difluorobenzophenone |
Sinonim |
(3,5-difluorophenyl)(phenyl)methanone |
MF |
C13H8F2O |
Berat Molekul |
218.1988 |
InChI |
InChI=1/C13H8F2O/c14-11-6-10(7-12(15)8-11)13(16)9-4-2-1-3-5-9/h1-8H |
CAS NO |
179113-89-4 |
Struktur Molekul |
|
Kepadatan |
1.239g/cm3 |
Titik lebur |
57-59℃ |
Titik didih |
310°C at 760 mmHg |
Indeks bias |
1.549 |
Titik nyala |
118.9°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|