ChemNet > CAS > 20485-41-0 4-methylthiazole-5-carboxylic acid
20485-41-0 4-methylthiazole-5-carboxylic acid
| Nama produk |
4-methylthiazole-5-carboxylic acid |
| Sinonim |
4-Methyl-thiazole-5-carboxylic acid; 4-Methylthiazole-5-Carboxylate; 4-methyl-1,3-thiazole-5-carboxylic acid; 4-Methyl-5-thiazolecarboxylic acid |
| MF |
C10H9NO |
| Berat Molekul |
159.1846 |
| InChI |
InChI=1/C10H9NO/c1-12-10-3-2-9-7-11-5-4-8(9)6-10/h2-7H,1H3 |
| CAS NO |
20485-41-0 |
| Struktur Molekul |
|
| Kepadatan |
1.131g/cm3 |
| Titik lebur |
250℃ |
| Titik didih |
295.593°C at 760 mmHg |
| Indeks bias |
1.611 |
| Titik nyala |
108.428°C |
| Cinta bahaya |
 Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
