ChemNet > CAS > 20485-41-0 4-methylthiazole-5-carboxylic acid
20485-41-0 4-methylthiazole-5-carboxylic acid
Nama produk |
4-methylthiazole-5-carboxylic acid |
Sinonim |
4-Methyl-thiazole-5-carboxylic acid; 4-Methylthiazole-5-Carboxylate; 4-methyl-1,3-thiazole-5-carboxylic acid; 4-Methyl-5-thiazolecarboxylic acid |
MF |
C10H9NO |
Berat Molekul |
159.1846 |
InChI |
InChI=1/C10H9NO/c1-12-10-3-2-9-7-11-5-4-8(9)6-10/h2-7H,1H3 |
CAS NO |
20485-41-0 |
Struktur Molekul |
|
Kepadatan |
1.131g/cm3 |
Titik lebur |
250℃ |
Titik didih |
295.593°C at 760 mmHg |
Indeks bias |
1.611 |
Titik nyala |
108.428°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|