ChemNet > CAS > 24044-07-3 2-(2-thienyl)-1,3-thiazole-4-carboxylic acid
24044-07-3 2-(2-thienyl)-1,3-thiazole-4-carboxylic acid
Nama produk |
2-(2-thienyl)-1,3-thiazole-4-carboxylic acid |
Sinonim |
2-(thiophen-2-yl)thiazole-4-carboxylic acid; 2-(2-thienyl)thiazole-4-carboxylic acid; 2-thiophen-2-yl-1,3-thiazole-4-carboxylate |
MF |
C8H4NO2S2 |
Berat Molekul |
210.2534 |
InChI |
InChI=1/C8H5NO2S2/c10-8(11)5-4-13-7(9-5)6-2-1-3-12-6/h1-4H,(H,10,11)/p-1 |
CAS NO |
24044-07-3 |
Struktur Molekul |
|
Titik lebur |
156℃ |
Titik didih |
441.5°C at 760 mmHg |
Titik nyala |
220.8°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|