ChemNet > CAS > 2444-37-3 (Methylthio)acetic acid
2444-37-3 (Methylthio)acetic acid
Nama produk |
(Methylthio)acetic acid |
Sinonim |
NSC 263480; (methylsulfanyl)acetic acid |
MF |
C3H6O2S |
Berat Molekul |
106.1435 |
InChI |
InChI=1/C3H6O2S/c1-6-2-3(4)5/h2H2,1H3,(H,4,5) |
CAS NO |
2444-37-3 |
EINECS |
219-483-6 |
Struktur Molekul |
|
Kepadatan |
1.224g/cm3 |
Titik lebur |
13-131℃ |
Titik didih |
225.9°C at 760 mmHg |
Indeks bias |
1.5 |
Titik nyala |
90.4°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|