ChemNet > CAS > 3128-06-1 4-acetylbutyric acid
3128-06-1 4-acetylbutyric acid
Nama produk |
4-acetylbutyric acid |
Sinonim |
5-oxohexanoic acid; Ketohexanoicacid; 5-Ketohexanoic acid~5-Oxohexanoic acid; 5-Ketohexanoic acid |
MF |
C6H10O3 |
Berat Molekul |
130.1418 |
InChI |
InChI=1/C6H10O3/c1-5(7)3-2-4-6(8)9/h2-4H2,1H3,(H,8,9) |
CAS NO |
3128-06-1 |
EINECS |
221-511-7 |
Struktur Molekul |
|
Kepadatan |
1.09g/cm3 |
Titik lebur |
13-14℃ |
Titik didih |
275.5°C at 760 mmHg |
Indeks bias |
1.439 |
Titik nyala |
134.6°C |
Cinta bahaya |
|
Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|