3887-02-3 N-Metil methacrylamide
Nama produk |
N-Metil methacrylamide |
Sinonim |
; N-Metil methacrylamide; N-Methyl methylacrylamide; N,2-dimethylprop-2-enamide |
Nama Inggeris |
N-Methyl methacrylamide; N-Methyl methacrylamide; N-Methyl methylacrylamide; N,2-dimethylprop-2-enamide |
MF |
C5H9NO |
Berat Molekul |
99.1311 |
InChI |
InChI=1/C5H9NO/c1-4(2)5(7)6-3/h1H2,2-3H3,(H,6,7) |
CAS NO |
3887-02-3 |
EINECS |
223-428-1 |
Struktur Molekul |
|
Kepadatan |
0.885g/cm3 |
Titik didih |
219.2°C at 760 mmHg |
Indeks bias |
1.421 |
Titik nyala |
113.7°C |
Tekanan wap |
0.121mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|