ChemNet > CAS > 43111-32-6 3-Chlorophenoxyacetonitrile
43111-32-6 3-Chlorophenoxyacetonitrile
Nama produk |
3-Chlorophenoxyacetonitrile |
MF |
C8H6ClNO |
Berat Molekul |
167.5923 |
InChI |
InChI=1/C8H6ClNO/c9-7-2-1-3-8(6-7)11-5-4-10/h1-3,6H,5H2 |
CAS NO |
43111-32-6 |
Struktur Molekul |
|
Kepadatan |
1.238g/cm3 |
Titik lebur |
30℃ |
Titik didih |
279.8°C at 760 mmHg |
Indeks bias |
1.538 |
Titik nyala |
123°C |
Cinta bahaya |
Xn:Harmful;
|
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Penerangan |
S36/37:Wear suitable protective clothing and gloves.;
|
|