ChemNet > CAS > 455-67-4 3-fluoropropiophenone
455-67-4 3-fluoropropiophenone
Nama produk |
3-fluoropropiophenone |
Sinonim |
3'-FLUOROPROPIOPHENONE; 1-(3-fluorophenyl)propan-1-one |
MF |
C9H9FO |
Berat Molekul |
152.1656 |
InChI |
InChI=1/C9H9FO/c1-2-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3 |
CAS NO |
455-67-4 |
Struktur Molekul |
|
Kepadatan |
1.074g/cm3 |
Titik didih |
209.8°C at 760 mmHg |
Indeks bias |
1.489 |
Titik nyala |
79.8°C |
Cinta bahaya |
|
Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|