ChemNet > CAS > 4593-90-2 (+/-)-3-phenylbutyric acid
4593-90-2 (+/-)-3-phenylbutyric acid
Nama produk |
(+/-)-3-phenylbutyric acid |
Sinonim |
3-Phenylbutyric acid; 3-phenylbutanoic acid |
MF |
C10H12O2 |
Berat Molekul |
164.2011 |
InChI |
InChI=1/C10H12O2/c1-8(7-10(11)12)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,11,12) |
CAS NO |
4593-90-2 |
EINECS |
224-987-4 |
Struktur Molekul |
|
Kepadatan |
1.09g/cm3 |
Titik lebur |
35-38℃ |
Titik didih |
288°C at 760 mmHg |
Indeks bias |
1.531 |
Titik nyala |
170.2°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|