ChemNet > CAS > 51707-38-1 3,4-Dimethoxybenzhydrazide
51707-38-1 3,4-Dimethoxybenzhydrazide
Nama produk |
3,4-Dimethoxybenzhydrazide |
Sinonim |
3,5-dimethoxybenzohydrazide; 3,5-Dimethoxybenzhydrazide |
MF |
C9H12N2O3 |
Berat Molekul |
196.2032 |
InChI |
InChI=1/C9H12N2O3/c1-13-7-3-6(9(12)11-10)4-8(5-7)14-2/h3-5H,10H2,1-2H3,(H,11,12) |
CAS NO |
51707-38-1 |
Struktur Molekul |
|
Kepadatan |
1.189g/cm3 |
Titik lebur |
143-144℃ |
Indeks bias |
1.544 |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|