ChemNet > CAS > 52178-50-4 methyl 3-formylbenzoate
52178-50-4 methyl 3-formylbenzoate
| Nama produk |
methyl 3-formylbenzoate |
| Sinonim |
Methyl benzaldehyde-4-carboxylate |
| MF |
C9H8O3 |
| Berat Molekul |
164.158 |
| InChI |
InChI=1/C9H8O3/c1-12-9(11)8-4-2-3-7(5-8)6-10/h2-6H,1H3 |
| CAS NO |
52178-50-4 |
| Struktur Molekul |
|
| Kepadatan |
1.181g/cm3 |
| Titik lebur |
48-55℃ |
| Titik didih |
272.8°C at 760 mmHg |
| Indeks bias |
1.557 |
| Titik nyala |
118.2°C |
| Cinta bahaya |
 Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
