Nama produk |
D-Glucitol, ethoxylated dan propoxylated (1 - 12.5 tahi lalat dan 1 - 12.5 tahi lalat propoxylated) |
Sinonim |
Polyoxyethylene (245) polyoxypropylene (6) sorbitol; PPG-6-Sorbeth-245; PPG-6-Sorbeth-500; Polyoxyethylene (500) polyoxypropylene (6) sorbitol; Polyoxypropylene (6) polyoxyethylene (245) sorbitol; Polyoxypropylene (6) polyoxyethylene (500) sorbitol; Poli(oxy(methyl-1,2-ethanediyl)oxy-1,2-ethanediyl), D-glucitol; Oxirane, 2-methyl-, polimer dengan oxirane, eter dengan D-glucitol (6:1); Oxirane, methyl-, polimer dengan oxirane, eter dengan D-glucitol (6:1); (2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol; 2-methyloxirane; Oxirane |
Nama Inggeris |
D-Glucitol, ethoxylated and propoxylated (1 - 12.5 moles ethoxylated and 1 - 12.5 moles propoxylated);Polyoxyethylene (245) polyoxypropylene (6) sorbitol; PPG-6-Sorbeth-245; PPG-6-Sorbeth-500; Polyoxyethylene (500) polyoxypropylene (6) sorbitol; Polyoxypropylene (6) polyoxyethylene (245) sorbitol; Polyoxypropylene (6) polyoxyethylene (500) sorbitol; Poly(oxy(methyl-1,2-ethanediyl)oxy-1,2-ethanediyl), D-glucitol; Oxirane, 2-methyl-, polymer with oxirane, ether with D-glucitol (6:1); Oxirane, methyl-, polymer with oxirane, ether with D-glucitol (6:1); (2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol; 2-methyloxirane; oxirane |
MF |
C36H74O18 |
Berat Molekul |
794.962 |
InChI |
InChI=1/C6H14O6.6C3H6O.6C2H4O/c7-1-3(9)5(11)6(12)4(10)2-8;6*1-3-2-4-3;6*1-2-3-1/h3-12H,1-2H2;6*3H,2H2,1H3;6*1-2H2/t3-,4+,5-,6-;;;;;;;;;;;;/m1............/s1 |
CAS NO |
56449-05-9 |
EINECS |
500-132-3 |
Struktur Molekul |
|
Titik didih |
494.9°C at 760 mmHg |
Titik nyala |
292.6°C |
Tekanan wap |
7.22E-12mmHg at 25°C |
|