| Nama produk |
theophylline--2-aminoethanol |
| Sinonim |
Theophylline olamine; Theophylline ethanolamine; Clysmathane; Etanol, 2-amino-, akaun.dengan theophylline (1:1); Fleet-theophylline; Monotheamin; Monotheamine; Monoxantil; Theamin; Kompaun theophylline dengan 2-aminoethanol (1:1); Theophylline monoethanolamine; Theopylline monoethanolamine; Unophyllin; 1H-Purine-2,6-dione, 3,7-dihydro-1,3-dimethyl-, compd.dengan 2-aminoethanol (1:1); Theophylline 2-aminoethanol; Theophylline, compd.with 2-aminoethanol (1:1); 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione - 2-aminoethanol (1:1) |
| Nama Inggeris |
theophylline--2-aminoethanol;Theophylline olamine; Theophylline ethanolamine; Clysmathane; Ethanol, 2-amino-, compd. with theophylline (1:1); Fleet-theophylline; Monotheamin; Monotheamine; Monoxantil; Theamin; Theophylline compound with 2-aminoethanol (1:1); Theophylline monoethanolamine; Theopylline monoethanolamine; Unophyllin; 1H-Purine-2,6-dione, 3,7-dihydro-1,3-dimethyl-, compd. with 2-aminoethanol (1:1); Theophylline 2-aminoethanol; Theophylline, compd. with 2-aminoethanol (1:1); 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione - 2-aminoethanol (1:1) |
| MF |
C9H15N5O3 |
| Berat Molekul |
241.2471 |
| InChI |
InChI=1/C7H8N4O2.C2H7NO/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;3-1-2-4/h3H,1-2H3,(H,8,9);4H,1-3H2 |
| CAS NO |
573-41-1 |
| EINECS |
209-355-8 |
| Struktur Molekul |
|
| Titik didih |
454.1°C at 760 mmHg |
| Titik nyala |
228.4°C |
| Tekanan wap |
1.96E-08mmHg at 25°C |
|