ChemNet > CAS > 611-79-0 3,3'-Diaminobenzophenone
611-79-0 3,3'-Diaminobenzophenone
Nama produk |
3,3'-Diaminobenzophenone |
Sinonim |
bis(3-aminophenyl)methanone |
MF |
C13H12N2O |
Berat Molekul |
212.2472 |
InChI |
InChI=1/C13H12N2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H,14-15H2 |
CAS NO |
611-79-0 |
EINECS |
210-281-3 |
Struktur Molekul |
|
Kepadatan |
1.233g/cm3 |
Titik didih |
469.4°C at 760 mmHg |
Indeks bias |
1.673 |
Titik nyala |
237.7°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|