ChemNet > CAS > 626-27-7 Heptanoic anhydride
626-27-7 Heptanoic anhydride
Nama produk |
Heptanoic anhydride |
Sinonim |
Enanthicanhydride; Oenanthic anhydride; Enanthic anhydride |
MF |
C14H26O3 |
Berat Molekul |
242.3544 |
InChI |
InChI=1/C14H26O3/c1-3-5-7-9-11-13(15)17-14(16)12-10-8-6-4-2/h3-12H2,1-2H3 |
CAS NO |
626-27-7 |
EINECS |
210-940-5 |
Struktur Molekul |
|
Kepadatan |
0.931g/cm3 |
Titik lebur |
-12℃ |
Titik didih |
269.5°C at 760 mmHg |
Indeks bias |
1.44 |
Titik nyala |
129.9°C |
Cinta bahaya |
C:Corrosive;
|
Kod Risiko |
R34:Causes burns.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|