ChemNet > CAS > 6590-97-2 2,3-Dichloroisothiocyanatobenzene
6590-97-2 2,3-Dichloroisothiocyanatobenzene
| Nama produk |
2,3-Dichloroisothiocyanatobenzene |
| MF |
C7H3Cl2NS |
| Berat Molekul |
204.0764 |
| InChI |
InChI=1/C7H3Cl2NS/c8-5-2-1-3-6(7(5)9)10-4-11/h1-3H |
| CAS NO |
6590-97-2 |
| Struktur Molekul |
|
| Kepadatan |
1.37g/cm3 |
| Titik didih |
311.3°C at 760 mmHg |
| Indeks bias |
1.614 |
| Titik nyala |
142.1°C |
| Cinta bahaya |
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
