ChemNet > CAS > 69038-81-9 2-Ethoxycinnamic acid
69038-81-9 2-Ethoxycinnamic acid
| Nama produk |
2-Ethoxycinnamic acid |
| Sinonim |
(2E)-3-(2-ethoxyphenyl)prop-2-enoic acid |
| MF |
C11H12O3 |
| Berat Molekul |
192.2112 |
| InChI |
InChI=1/C11H12O3/c1-2-14-10-6-4-3-5-9(10)7-8-11(12)13/h3-8H,2H2,1H3,(H,12,13)/b8-7+ |
| CAS NO |
69038-81-9 |
| Struktur Molekul |
|
| Kepadatan |
1.161g/cm3 |
| Titik lebur |
134-138℃ |
| Titik didih |
337.2°C at 760 mmHg |
| Indeks bias |
1.579 |
| Titik nyala |
131.7°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
