ChemNet > CAS > 72065-23-7 N-Acryloylsarcosine methyl ester
72065-23-7 N-Acryloylsarcosine methyl ester
Nama produk |
N-Acryloylsarcosine methyl ester |
Sinonim |
methyl N-acryloyl-N-methylglycinate |
MF |
C7H11NO3 |
Berat Molekul |
157.1671 |
InChI |
InChI=1/C7H11NO3/c1-4-6(9)8(2)5-7(10)11-3/h4H,1,5H2,2-3H3 |
CAS NO |
72065-23-7 |
Struktur Molekul |
|
Kepadatan |
1.068g/cm3 |
Titik didih |
276.3°C at 760 mmHg |
Indeks bias |
1.452 |
Titik nyala |
120.9°C |
Cinta bahaya |
|
Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|