ChemNet > CAS > 81321-10-0 metil 3-isothiocyanatothiophene-2-carboxylate
81321-10-0 metil 3-isothiocyanatothiophene-2-carboxylate
| Nama produk |
metil 3-isothiocyanatothiophene-2-carboxylate |
| Nama Inggeris |
methyl 3-isothiocyanatothiophene-2-carboxylate; |
| MF |
C7H5NO2S2 |
| Berat Molekul |
199.2501 |
| InChI |
InChI=1/C7H5NO2S2/c1-10-7(9)6-5(8-4-11)2-3-12-6/h2-3H,1H3 |
| CAS NO |
81321-10-0 |
| Struktur Molekul |
|
| Kepadatan |
1.35g/cm3 |
| Titik lebur |
56℃ |
| Titik didih |
340.3°C at 760 mmHg |
| Indeks bias |
1.63 |
| Titik nyala |
159.6°C |
| Tekanan wap |
8.7E-05mmHg at 25°C |
| Cinta bahaya |
Xn:Harmful;
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|