9003-42-3 Poli(etil methacrylate)
Nama produk |
Poli(etil methacrylate) |
Sinonim |
; Ethyl Methacrylate Resin; etil 2-methylprop-2-enoate |
Nama Inggeris |
Poly(ethyl methacrylate); Ethyl Methacrylate Resin; ethyl 2-methylprop-2-enoate |
MF |
C6H10O2 |
Berat Molekul |
114.1424 |
InChI |
InChI=1/C6H10O2/c1-4-8-6(7)5(2)3/h2,4H2,1,3H3 |
CAS NO |
9003-42-3 |
EINECS |
202-597-5 |
Struktur Molekul |
|
Kepadatan |
0.906g/cm3 |
Titik didih |
120.5°C at 760 mmHg |
Indeks bias |
1.409 |
Titik nyala |
15.6°C |
Tekanan wap |
15.2mmHg at 25°C |
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|