ChemNet > CAS > 94-46-2 isopentyl benzoate
94-46-2 isopentyl benzoate
| Nama produk |
isopentyl benzoate |
| Sinonim |
Benzoic acid isoamyl ester; 3-methyl-1-butanol benzoate; benzoic acid isopentyl ester; Isoamyl Benzoate; 3-methylbutyl benzoate |
| MF |
C12H16O2 |
| Berat Molekul |
192.2542 |
| InChI |
InChI=1/C12H16O2/c1-10(2)8-9-14-12(13)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3 |
| CAS NO |
94-46-2 |
| EINECS |
202-334-4 |
| Struktur Molekul |
|
| Kepadatan |
0.992g/cm3 |
| Titik didih |
260°C at 760 mmHg |
| Indeks bias |
1.495 |
| Titik nyala |
109.4°C |
| Cinta bahaya |
|
| Kod Risiko |
|
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|
