ChemNet > CAS > 100859-84-5 2-Chloro isonicotinamide
100859-84-5 2-Chloro isonicotinamide
| Naam product |
2-Chloro isonicotinamide |
| Synoniemen |
6-methyl-5-nitropyridin-2(1H)-one; 2-chloropyridine-4-carboxamide |
| MF |
C6H5ClN2O |
| Molecuulgewicht |
156.5697 |
| InChI |
InChI=1/C6H5ClN2O/c7-5-3-4(6(8)10)1-2-9-5/h1-3H,(H2,8,10) |
| CAS-nummer |
100859-84-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.381g/cm3 |
| Smeltpunt |
193℃ |
| Kookpunt |
312.2°C at 760 mmHg |
| Brekingsindex |
1.588 |
| Vlampunt |
142.6°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
