ChemNet > CAS > 100888-40-2 n-Tetradecylboronic acid
100888-40-2 n-Tetradecylboronic acid
| Naam product |
n-Tetradecylboronic acid |
| Synoniemen |
Myristylboronic acid~n-Tetradecaneboronic acid; tetradecylboronic acid |
| MF |
C14H31BO2 |
| Molecuulgewicht |
242.2057 |
| InChI |
InChI=1/C14H31BO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h16-17H,2-14H2,1H3 |
| CAS-nummer |
100888-40-2 |
| Moleculaire Structuur |
|
| Dichtheid |
0.875g/cm3 |
| Kookpunt |
360.9°C at 760 mmHg |
| Brekingsindex |
1.443 |
| Vlampunt |
172.1°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
