ChemNet > CAS > 10443-65-9 2-bromoacrylic acid
10443-65-9 2-bromoacrylic acid
Naam product |
2-bromoacrylic acid |
Synoniemen |
2-Bromoacrylic acid; CCRIS 5478; NSC 227848; 2-bromoprop-2-enoic acid; 2-bromoprop-2-enoate |
MF |
C3H2BrO2 |
Molecuulgewicht |
149.9513 |
InChI |
InChI=1/C3H3BrO2/c1-2(4)3(5)6/h1H2,(H,5,6)/p-1 |
CAS-nummer |
10443-65-9 |
EINECS |
233-928-1 |
Moleculaire Structuur |
|
Smeltpunt |
62-65℃ |
Kookpunt |
224.5°C at 760 mmHg |
Vlampunt |
89.6°C |
Gevaarsymbolen |
|
Risico-codes |
R34:Causes burns.;
R43:May cause sensitization by skin contact.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|