ChemNet > CAS > 116493-07-3 4-cyaan-3-(4-methoxyfenyl)-5-(methylthio)thiofeen-2-carbonzuur
116493-07-3 4-cyaan-3-(4-methoxyfenyl)-5-(methylthio)thiofeen-2-carbonzuur
| Naam product |
4-cyaan-3-(4-methoxyfenyl)-5-(methylthio)thiofeen-2-carbonzuur |
| Synoniemen |
4-cyano-3-(4-methoxyfenyl)-5-(methylsulfanyl)thiofeen-2-carbonzuur |
| Engelse naam |
4-cyano-3-(4-methoxyphenyl)-5-(methylthio)thiophene-2-carboxylic acid;4-cyano-3-(4-methoxyphenyl)-5-(methylsulfanyl)thiophene-2-carboxylic acid |
| MF |
C14H11NO3S2 |
| Molecuulgewicht |
305.372 |
| InChI |
InChI=1/C14H11NO3S2/c1-18-9-5-3-8(4-6-9)11-10(7-15)14(19-2)20-12(11)13(16)17/h3-6H,1-2H3,(H,16,17) |
| CAS-nummer |
116493-07-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.43g/cm3 |
| Smeltpunt |
209℃ |
| Kookpunt |
464.9°C at 760 mmHg |
| Brekingsindex |
1.67 |
| Vlampunt |
234.9°C |
| Dampdruk |
1.93E-09mmHg at 25°C |
| Gevaarsymbolen |
Xn:Harmful;
|
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|