ChemNet > CAS > 128676-84-6 2-Chloroquinoline-3-boronic acid
128676-84-6 2-Chloroquinoline-3-boronic acid
| Naam product |
2-Chloroquinoline-3-boronic acid |
| Synoniemen |
(2-chloroquinolin-3-yl)boronic acid; 2-Chloroquinolin-3-boronic acid |
| MF |
C9H7BClNO2 |
| Molecuulgewicht |
207.4214 |
| InChI |
InChI=1/C9H7BClNO2/c11-9-7(10(13)14)5-6-3-1-2-4-8(6)12-9/h1-5,13-14H |
| CAS-nummer |
128676-84-6 |
| Moleculaire Structuur |
|
| Dichtheid |
1.42g/cm3 |
| Kookpunt |
426.2°C at 760 mmHg |
| Brekingsindex |
1.657 |
| Vlampunt |
211.5°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
