ChemNet > CAS > 1323-42-8 hydroxyoctadecaanzuur, monoester met glycerol
1323-42-8 hydroxyoctadecaanzuur, monoester met glycerol
| Naam product |
hydroxyoctadecaanzuur, monoester met glycerol |
| Synoniemen |
Glycerylhydroxystearaat; Hydroxystearinezuur, monoester met glycerol; Stearinezuur, hydroxy-, monoester met glycerol; Hydroxyoctadecaanzuur, monoester met glycerol; Octadecaanzuur, hydroxy-, monoester met 1,2,3-propaantriol; 1,3-dihydroxypropaan-2-yl 2-hydroxyoctadecanoaat |
| Engelse naam |
hydroxyoctadecanoic acid, monoester with glycerol;Glyceryl hydroxystearate; Hydroxystearic acid, monoester with glycerol; Stearic acid, hydroxy-, monoester with glycerol; Hydroxyoctadecanoic acid, monoester with glycerol; Octadecanoic acid, hydroxy-, monoester with 1,2,3-propanetriol; 1,3-dihydroxypropan-2-yl 2-hydroxyoctadecanoate |
| MF |
C21H42O5 |
| Molecuulgewicht |
374.5552 |
| InChI |
InChI=1/C21H42O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20(24)21(25)26-19(17-22)18-23/h19-20,22-24H,2-18H2,1H3 |
| CAS-nummer |
1323-42-8 |
| EINECS |
215-355-9 |
| Moleculaire Structuur |
|
| Dichtheid |
1.007g/cm3 |
| Kookpunt |
520.5°C at 760 mmHg |
| Brekingsindex |
1.479 |
| Vlampunt |
168.9°C |
| Dampdruk |
5.21E-13mmHg at 25°C |
|