ChemNet > CAS > 14294-09-8 1-Piperidinethiocarboxamide
14294-09-8 1-Piperidinethiocarboxamide
Naam product |
1-Piperidinethiocarboxamide |
Synoniemen |
piperidine-1-carbothioamide |
MF |
C6H12N2S |
Molecuulgewicht |
144.2379 |
InChI |
InChI=1/C6H12N2S/c7-6(9)8-4-2-1-3-5-8/h1-5H2,(H2,7,9) |
CAS-nummer |
14294-09-8 |
Moleculaire Structuur |
|
Dichtheid |
1.165g/cm3 |
Kookpunt |
237.3°C at 760 mmHg |
Brekingsindex |
1.593 |
Vlampunt |
97.3°C |
Gevaarsymbolen |
|
Risico-codes |
R20/22:Harmful by inhalation and if swallowed.;
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|