ChemNet > CAS > 153435-96-2 ethyl 4,6-dichloro-3-formyl-1H-indole-2-carboxylate
153435-96-2 ethyl 4,6-dichloro-3-formyl-1H-indole-2-carboxylate
Naam product |
ethyl 4,6-dichloro-3-formyl-1H-indole-2-carboxylate |
MF |
C12H9Cl2NO3 |
Molecuulgewicht |
286.1108 |
InChI |
InChI=1/C12H9Cl2NO3/c1-2-18-12(17)11-7(5-16)10-8(14)3-6(13)4-9(10)15-11/h3-5,15H,2H2,1H3 |
CAS-nummer |
153435-96-2 |
Moleculaire Structuur |
|
Dichtheid |
1.491g/cm3 |
Smeltpunt |
214℃ |
Kookpunt |
485.1°C at 760 mmHg |
Brekingsindex |
1.667 |
Vlampunt |
247.2°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|