ChemNet > CAS > 1551-44-6 cyclohexyl butyrate
1551-44-6 cyclohexyl butyrate
Naam product |
cyclohexyl butyrate |
Synoniemen |
Cyclohexyl butyrate,(Butyric acid cyclohexyl ester); Butyric acid cyclohexyl ester; cyclohexyl butanoate |
MF |
C10H18O2 |
Molecuulgewicht |
170.2487 |
InChI |
InChI=1/C10H18O2/c1-2-6-10(11)12-9-7-4-3-5-8-9/h9H,2-8H2,1H3 |
CAS-nummer |
1551-44-6 |
EINECS |
216-290-9 |
Moleculaire Structuur |
|
Dichtheid |
0.94g/cm3 |
Kookpunt |
214.9°C at 760 mmHg |
Brekingsindex |
1.449 |
Vlampunt |
78°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|