ChemNet > CAS > 1582-24-7 2,3,4,5,6-Pentafluorobenzeneboronic acid
1582-24-7 2,3,4,5,6-Pentafluorobenzeneboronic acid
Naam product |
2,3,4,5,6-Pentafluorobenzeneboronic acid |
Synoniemen |
2,3,4,5,6-Pentafluorophenylboronic acid; Pentafluorophenylboronic acid; (pentafluorophenyl)boronic acid |
MF |
C6H2BF5O2 |
Molecuulgewicht |
211.8819 |
InChI |
InChI=1/C6H2BF5O2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h13-14H |
CAS-nummer |
1582-24-7 |
Moleculaire Structuur |
|
Dichtheid |
1.61g/cm3 |
Kookpunt |
244°C at 760 mmHg |
Brekingsindex |
1.429 |
Vlampunt |
101.4°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|