ChemNet > CAS > 1670-46-8 2-Acetylcyclopentanone
1670-46-8 2-Acetylcyclopentanone
| Naam product |
2-Acetylcyclopentanone |
| Synoniemen |
Cyclopentanone, 2-acetyl-; 4-07-00-01993 (Beilstein Handbook Reference); AI3-19254; BRN 1857601; NSC 141181; alpha-Acetylcyclopentanone; o-Acetylcyclopentanone; 2-Acetylcyclopentan-1-one; (2S)-2-acetylcyclopentanone; 1-(2-hydroxycyclopent-1-en-1-yl)ethanone |
| MF |
C7H10O2 |
| Molecuulgewicht |
126.1531 |
| InChI |
InChI=1/C7H10O2/c1-5(8)6-3-2-4-7(6)9/h9H,2-4H2,1H3 |
| CAS-nummer |
1670-46-8 |
| EINECS |
216-797-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.187g/cm3 |
| Kookpunt |
239.2°C at 760 mmHg |
| Brekingsindex |
1.542 |
| Vlampunt |
97.8°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
