ChemNet > CAS > 177756-62-6 3-Fluoro-4-methylbenzaldehyde
177756-62-6 3-Fluoro-4-methylbenzaldehyde
Naam product |
3-Fluoro-4-methylbenzaldehyde |
Synoniemen |
3-Fluoro-p-tolualdehyde |
MF |
C8H7FO |
Molecuulgewicht |
138.139 |
InChI |
InChI=1/C8H7FO/c1-6-2-3-7(5-10)4-8(6)9/h2-5H,1H3 |
CAS-nummer |
177756-62-6 |
Moleculaire Structuur |
|
Dichtheid |
1.136g/cm3 |
Kookpunt |
198.3°C at 760 mmHg |
Brekingsindex |
1.534 |
Vlampunt |
80.1°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|