ChemNet > CAS > 1779-10-8 1,6-Dibromo-2-hydroxynaphthalene-3-carboxylic acid
1779-10-8 1,6-Dibromo-2-hydroxynaphthalene-3-carboxylic acid
Naam product |
1,6-Dibromo-2-hydroxynaphthalene-3-carboxylic acid |
Synoniemen |
1,6-Dibromo-2-naphthol-3-carboxylic acid; 4,7-dibromo-3-hydroxynaphthalene-2-carboxylic acid; 4,7-dibromo-3-hydroxynaphthalene-2-carboxylate |
MF |
C11H5Br2O3 |
Molecuulgewicht |
344.9641 |
InChI |
InChI=1/C11H6Br2O3/c12-6-1-2-7-5(3-6)4-8(11(15)16)10(14)9(7)13/h1-4,14H,(H,15,16)/p-1 |
CAS-nummer |
1779-10-8 |
EINECS |
217-214-7 |
Moleculaire Structuur |
|
Smeltpunt |
251-253℃ |
Kookpunt |
427.6°C at 760 mmHg |
Vlampunt |
212.4°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|