ChemNet > CAS > 18719-43-2 diethyl (3-chloropropyl)malonate
18719-43-2 diethyl (3-chloropropyl)malonate
Naam product |
diethyl (3-chloropropyl)malonate |
Synoniemen |
(3-Chloropropyl)malonic acid diethyl ester; diethyl (3-chloropropyl)propanedioate |
MF |
C10H17ClO4 |
Molecuulgewicht |
236.6926 |
InChI |
InChI=1/C10H17ClO4/c1-3-14-9(12)8(6-5-7-11)10(13)15-4-2/h8H,3-7H2,1-2H3 |
CAS-nummer |
18719-43-2 |
Moleculaire Structuur |
|
Dichtheid |
1.114g/cm3 |
Kookpunt |
290.2°C at 760 mmHg |
Brekingsindex |
1.447 |
Vlampunt |
111.9°C |
Gevaarsymbolen |
|
Risico-codes |
R36/38:Irritating to eyes and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|