ChemNet > CAS > 18962-05-5 4-Isopropoxybenzaldehyde
18962-05-5 4-Isopropoxybenzaldehyde
Naam product |
4-Isopropoxybenzaldehyde |
Synoniemen |
4-(propan-2-yloxy)benzaldehyde |
MF |
C10H12O2 |
Molecuulgewicht |
164.2011 |
InChI |
InChI=1/C10H12O2/c1-8(2)12-10-5-3-9(7-11)4-6-10/h3-8H,1-2H3 |
CAS-nummer |
18962-05-5 |
Moleculaire Structuur |
|
Dichtheid |
1.036g/cm3 |
Kookpunt |
264.2°C at 760 mmHg |
Brekingsindex |
1.529 |
Vlampunt |
112.9°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|