ChemNet > CAS > 19144-86-6 (S)-(-)-N-Acetyl-1-methylbenzylamine
19144-86-6 (S)-(-)-N-Acetyl-1-methylbenzylamine
Naam product |
(S)-(-)-N-Acetyl-1-methylbenzylamine |
Synoniemen |
(3beta)-3-hydroxycholest-5-en-22-one; N-[(1S)-1-phenylethyl]acetamide |
MF |
C10H13NO |
Molecuulgewicht |
163.2163 |
InChI |
InChI=1/C10H13NO/c1-8(11-9(2)12)10-6-4-3-5-7-10/h3-8H,1-2H3,(H,11,12)/t8-/m0/s1 |
CAS-nummer |
19144-86-6 |
Moleculaire Structuur |
|
Dichtheid |
1.007g/cm3 |
Smeltpunt |
102℃ |
Kookpunt |
327.9°C at 760 mmHg |
Brekingsindex |
1.513 |
Vlampunt |
192.2°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|