ChemNet > CAS > 19234-20-9 (2-isopropoxyethyl)acetaat
19234-20-9 (2-isopropoxyethyl)acetaat
Naam product |
(2-isopropoxyethyl)acetaat |
Synoniemen |
Isopropylglycolacetaat; Ethyleenglycolmonoisopropyletheracetaat; 2-(propaan-2-yloxy)ethylacetaat |
Engelse naam |
(2-Isopropoxyethyl) acetate; Isopropylglycol acetate; Ethyleneglycol monoisopropyl ether acetate; 2-(propan-2-yloxy)ethyl acetate |
MF |
C7H14O3 |
Molecuulgewicht |
146.1843 |
InChI |
InChI=1/C7H14O3/c1-6(2)9-4-5-10-7(3)8/h6H,4-5H2,1-3H3 |
CAS-nummer |
19234-20-9 |
EINECS |
242-901-3 |
Moleculaire Structuur |
|
Dichtheid |
0.947g/cm3 |
Kookpunt |
177.6°C at 760 mmHg |
Brekingsindex |
1.406 |
Vlampunt |
56.8°C |
Dampdruk |
1.03mmHg at 25°C |
Risico-codes |
R10:Flammable.;
|
Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|