ChemNet > CAS > 201058-08-4 Wang resin
201058-08-4 Wang resin
| Naam product |
Wang resin |
| Synoniemen |
4-Benzyloxybenzyl alcohol, polymer-supported~Polystyrene PHB; [4-(Hydroxymethyl)phenoxymethyl]polystyrene divinylbenzene copolymer; {4-[(4-methylbenzyl)oxy]phenyl}methanol |
| MF |
C15H16O2 |
| Molecuulgewicht |
228.2863 |
| InChI |
InChI=1/C15H16O2/c1-12-2-4-14(5-3-12)11-17-15-8-6-13(10-16)7-9-15/h2-9,16H,10-11H2,1H3 |
| CAS-nummer |
201058-08-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.117g/cm3 |
| Kookpunt |
386.2°C at 760 mmHg |
| Brekingsindex |
1.587 |
| Vlampunt |
175.2°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
