ChemNet > CAS > 20595-44-2 2,3-Dichlorocinnamic acid
20595-44-2 2,3-Dichlorocinnamic acid
Naam product |
2,3-Dichlorocinnamic acid |
Synoniemen |
(2E)-3-(2,3-dichlorophenyl)prop-2-enoate; (2E)-3-(2,3-dichlorophenyl)prop-2-enoic acid |
MF |
C9H6Cl2O2 |
Molecuulgewicht |
217.0487 |
InChI |
InChI=1/C9H6Cl2O2/c10-7-3-1-2-6(9(7)11)4-5-8(12)13/h1-5H,(H,12,13)/b5-4+ |
CAS-nummer |
20595-44-2 |
Moleculaire Structuur |
|
Dichtheid |
1.457g/cm3 |
Kookpunt |
363°C at 760 mmHg |
Brekingsindex |
1.637 |
Vlampunt |
173.3°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|