ChemNet > CAS > 20676-54-4 Methyl 2-acetamido-5-chlorobenzoate
20676-54-4 Methyl 2-acetamido-5-chlorobenzoate
Naam product |
Methyl 2-acetamido-5-chlorobenzoate |
Synoniemen |
2-Acetamido-5-chlorobenzoic acid methyl ester~N-Acetyl-5-chloroanthranilic acid methyl ester; methyl 2-(acetylamino)-5-chlorobenzoate |
MF |
C10H10ClNO3 |
Molecuulgewicht |
227.6443 |
InChI |
InChI=1/C10H10ClNO3/c1-6(13)12-9-4-3-7(11)5-8(9)10(14)15-2/h3-5H,1-2H3,(H,12,13) |
CAS-nummer |
20676-54-4 |
Moleculaire Structuur |
|
Dichtheid |
1.32g/cm3 |
Smeltpunt |
126-130℃ |
Kookpunt |
409°C at 760 mmHg |
Brekingsindex |
1.577 |
Vlampunt |
201.2°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|